C18H15Cl2N3O3S — CID 4751381
2-[5-[(2,4-dichlorophenoxy)methyl]-2-sulfanylidene-1,3,4-oxadiazol-3-yl]-N-(3-methylphenyl)acetamide (PubChem CID 4751381) has the molecular formula C18H15Cl2N3O3S and a molecular weight of 424.31 g/mol. Its IUPAC name is 2-[5-[(2,4-dichlorophenoxy)methyl]-2-sulfanylidene-1,3,4-oxadiazol-3-yl]-N-(3-methylphenyl)acetamide.
| Compound Name | 2-[5-[(2,4-dichlorophenoxy)methyl]-2-sulfanylidene-1,3,4-oxadiazol-3-yl]-N-(3-methylphenyl)acetamide |
|---|---|
| PubChem CID | 4751381 |
| Molecular Formula | C18H15Cl2N3O3S |
| Molecular Weight | 424.31 g/mol |
| Exact Mass | 423.02 |
| IUPAC Name | 2-[5-[(2,4-dichlorophenoxy)methyl]-2-sulfanylidene-1,3,4-oxadiazol-3-yl]-N-(3-methylphenyl)acetamide |
| SMILES | Cc1cccc(NC(=O)Cn2nc(COc3ccc(Cl)cc3Cl)oc2=S)c1 |
| InChI | InChI=1S/C18H15Cl2N3O3S/c1-11-3-2-4-13(7-11)21-16(24)9-23-18(27)26-17(22-23)10-25-15-6-5-12(19)8-14(15)20/h2-8H,9-10H2,1H3,(H,21,24) |
| InChIKey | LFQGAHXSPVDGTI-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 69.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.31 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|