C18H15BrClN3O3S — CID 126176088
N-(3-bromo-4-chlorophenyl)-2-[5-[(4-methylphenoxy)methyl]-2-sulfanylidene-1,3,4-oxadiazol-3-yl]acetamide (PubChem CID 126176088) has the molecular formula C18H15BrClN3O3S and a molecular weight of 468.76 g/mol. Its IUPAC name is N-(3-bromo-4-chlorophenyl)-2-[5-[(4-methylphenoxy)methyl]-2-sulfanylidene-1,3,4-oxadiazol-3-yl]acetamide.
| Compound Name | N-(3-bromo-4-chlorophenyl)-2-[5-[(4-methylphenoxy)methyl]-2-sulfanylidene-1,3,4-oxadiazol-3-yl]acetamide |
|---|---|
| PubChem CID | 126176088 |
| Molecular Formula | C18H15BrClN3O3S |
| Molecular Weight | 468.76 g/mol |
| Exact Mass | 466.97 |
| IUPAC Name | N-(3-bromo-4-chlorophenyl)-2-[5-[(4-methylphenoxy)methyl]-2-sulfanylidene-1,3,4-oxadiazol-3-yl]acetamide |
| SMILES | Cc1ccc(OCc2nn(CC(=O)Nc3ccc(Cl)c(Br)c3)c(=S)o2)cc1 |
| InChI | InChI=1S/C18H15BrClN3O3S/c1-11-2-5-13(6-3-11)25-10-17-22-23(18(27)26-17)9-16(24)21-12-4-7-15(20)14(19)8-12/h2-8H,9-10H2,1H3,(H,21,24) |
| InChIKey | RRNWAZYSLJCAOG-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 69.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.76 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|