C15H14FN5O3S — CID 139228041
3-[[(4,6-dimethoxypyrimidin-2-yl)amino]methyl]-5-(4-fluorophenyl)-1,3,4-oxadiazole-2-thione (PubChem CID 139228041) has the molecular formula C15H14FN5O3S and a molecular weight of 363.37 g/mol. Its IUPAC name is 3-[[(4,6-dimethoxypyrimidin-2-yl)amino]methyl]-5-(4-fluorophenyl)-1,3,4-oxadiazole-2-thione.
| Compound Name | 3-[[(4,6-dimethoxypyrimidin-2-yl)amino]methyl]-5-(4-fluorophenyl)-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 139228041 |
| Molecular Formula | C15H14FN5O3S |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | 3-[[(4,6-dimethoxypyrimidin-2-yl)amino]methyl]-5-(4-fluorophenyl)-1,3,4-oxadiazole-2-thione |
| SMILES | COc1cc(OC)nc(NCn2nc(-c3ccc(F)cc3)oc2=S)n1 |
| InChI | InChI=1S/C15H14FN5O3S/c1-22-11-7-12(23-2)19-14(18-11)17-8-21-15(25)24-13(20-21)9-3-5-10(16)6-4-9/h3-7H,8H2,1-2H3,(H,17,18,19) |
| InChIKey | WAUZDOAFMDUDJN-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 87.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|