C22H23N5O3S — CID 55430163
5-(3,4-dimethoxyphenyl)-3-[[methyl-[(1-phenylpyrazol-4-yl)methyl]amino]methyl]-1,3,4-oxadiazole-2-thione (PubChem CID 55430163) has the molecular formula C22H23N5O3S and a molecular weight of 437.53 g/mol. Its IUPAC name is 5-(3,4-dimethoxyphenyl)-3-[[methyl-[(1-phenylpyrazol-4-yl)methyl]amino]methyl]-1,3,4-oxadiazole-2-thione.
| Compound Name | 5-(3,4-dimethoxyphenyl)-3-[[methyl-[(1-phenylpyrazol-4-yl)methyl]amino]methyl]-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 55430163 |
| Molecular Formula | C22H23N5O3S |
| Molecular Weight | 437.53 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | 5-(3,4-dimethoxyphenyl)-3-[[methyl-[(1-phenylpyrazol-4-yl)methyl]amino]methyl]-1,3,4-oxadiazole-2-thione |
| SMILES | COc1ccc(-c2nn(CN(C)Cc3cnn(-c4ccccc4)c3)c(=S)o2)cc1OC |
| InChI | InChI=1S/C22H23N5O3S/c1-25(13-16-12-23-26(14-16)18-7-5-4-6-8-18)15-27-22(31)30-21(24-27)17-9-10-19(28-2)20(11-17)29-3/h4-12,14H,13,15H2,1-3H3 |
| InChIKey | RMXGHMADCALSRT-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 70.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.53 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|