C18H18ClN3O2S — CID 2688317
3-[[(3-chlorophenyl)methyl-methylamino]methyl]-5-(4-methoxyphenyl)-1,3,4-oxadiazole-2-thione (PubChem CID 2688317) has the molecular formula C18H18ClN3O2S and a molecular weight of 375.88 g/mol. Its IUPAC name is 3-[[(3-chlorophenyl)methyl-methylamino]methyl]-5-(4-methoxyphenyl)-1,3,4-oxadiazole-2-thione.
| Compound Name | 3-[[(3-chlorophenyl)methyl-methylamino]methyl]-5-(4-methoxyphenyl)-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 2688317 |
| Molecular Formula | C18H18ClN3O2S |
| Molecular Weight | 375.88 g/mol |
| Exact Mass | 375.08 |
| IUPAC Name | 3-[[(3-chlorophenyl)methyl-methylamino]methyl]-5-(4-methoxyphenyl)-1,3,4-oxadiazole-2-thione |
| SMILES | COc1ccc(-c2nn(CN(C)Cc3cccc(Cl)c3)c(=S)o2)cc1 |
| InChI | InChI=1S/C18H18ClN3O2S/c1-21(11-13-4-3-5-15(19)10-13)12-22-18(25)24-17(20-22)14-6-8-16(23-2)9-7-14/h3-10H,11-12H2,1-2H3 |
| InChIKey | DICOKLXYTAJQTC-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 43.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.88 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|