C17H15ClN2O2S — CID 134915147
6-(4-chlorophenyl)-2-(4-methoxyphenyl)-3-methyl-2H-1,3,5-oxadiazine-4-thione (PubChem CID 134915147) has the molecular formula C17H15ClN2O2S and a molecular weight of 346.84 g/mol. Its IUPAC name is 6-(4-chlorophenyl)-2-(4-methoxyphenyl)-3-methyl-2H-1,3,5-oxadiazine-4-thione.
| Compound Name | 6-(4-chlorophenyl)-2-(4-methoxyphenyl)-3-methyl-2H-1,3,5-oxadiazine-4-thione |
|---|---|
| PubChem CID | 134915147 |
| Molecular Formula | C17H15ClN2O2S |
| Molecular Weight | 346.84 g/mol |
| Exact Mass | 346.05 |
| IUPAC Name | 6-(4-chlorophenyl)-2-(4-methoxyphenyl)-3-methyl-2H-1,3,5-oxadiazine-4-thione |
| SMILES | COc1ccc(C2OC(c3ccc(Cl)cc3)=NC(=S)N2C)cc1 |
| InChI | InChI=1S/C17H15ClN2O2S/c1-20-16(12-5-9-14(21-2)10-6-12)22-15(19-17(20)23)11-3-7-13(18)8-4-11/h3-10,16H,1-2H3 |
| InChIKey | MGJAQBRQXBRZGP-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.84 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|