C18H14ClN5O2S — CID 46236421
6-(4-chlorophenyl)-2-(4-methoxyphenyl)-3-(1,2,4-triazol-4-yl)-2H-1,3,5-oxadiazine-4-thione (PubChem CID 46236421) has the molecular formula C18H14ClN5O2S and a molecular weight of 399.86 g/mol. Its IUPAC name is 6-(4-chlorophenyl)-2-(4-methoxyphenyl)-3-(1,2,4-triazol-4-yl)-2H-1,3,5-oxadiazine-4-thione.
| Compound Name | 6-(4-chlorophenyl)-2-(4-methoxyphenyl)-3-(1,2,4-triazol-4-yl)-2H-1,3,5-oxadiazine-4-thione |
|---|---|
| PubChem CID | 46236421 |
| Molecular Formula | C18H14ClN5O2S |
| Molecular Weight | 399.86 g/mol |
| Exact Mass | 399.06 |
| IUPAC Name | 6-(4-chlorophenyl)-2-(4-methoxyphenyl)-3-(1,2,4-triazol-4-yl)-2H-1,3,5-oxadiazine-4-thione |
| SMILES | COc1ccc(C2OC(c3ccc(Cl)cc3)=NC(=S)N2n2cnnc2)cc1 |
| InChI | InChI=1S/C18H14ClN5O2S/c1-25-15-8-4-13(5-9-15)17-24(23-10-20-21-11-23)18(27)22-16(26-17)12-2-6-14(19)7-3-12/h2-11,17H,1H3 |
| InChIKey | KMIXJNNFFXVLPE-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 64.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.86 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|