C24H21ClN2O4S — CID 134118251
6-(4-chlorophenyl)-3-(2,5-dimethoxyphenyl)-2-(4-methoxyphenyl)-2H-1,3,5-oxadiazine-4-thione (PubChem CID 134118251) has the molecular formula C24H21ClN2O4S and a molecular weight of 468.96 g/mol. Its IUPAC name is 6-(4-chlorophenyl)-3-(2,5-dimethoxyphenyl)-2-(4-methoxyphenyl)-2H-1,3,5-oxadiazine-4-thione.
| Compound Name | 6-(4-chlorophenyl)-3-(2,5-dimethoxyphenyl)-2-(4-methoxyphenyl)-2H-1,3,5-oxadiazine-4-thione |
|---|---|
| PubChem CID | 134118251 |
| Molecular Formula | C24H21ClN2O4S |
| Molecular Weight | 468.96 g/mol |
| Exact Mass | 468.09 |
| IUPAC Name | 6-(4-chlorophenyl)-3-(2,5-dimethoxyphenyl)-2-(4-methoxyphenyl)-2H-1,3,5-oxadiazine-4-thione |
| SMILES | COc1ccc(C2OC(c3ccc(Cl)cc3)=NC(=S)N2c2cc(OC)ccc2OC)cc1 |
| InChI | InChI=1S/C24H21ClN2O4S/c1-28-18-10-6-16(7-11-18)23-27(20-14-19(29-2)12-13-21(20)30-3)24(32)26-22(31-23)15-4-8-17(25)9-5-15/h4-14,23H,1-3H3 |
| InChIKey | BDLSAPBFMVVQKC-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 52.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.96 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|