C19H17ClN2O5 — CID 95053147
[2-[(2R)-3-acetyl-2-(4-methoxyphenyl)-2H-1,3,4-oxadiazol-5-yl]-4-chlorophenyl] acetate (PubChem CID 95053147) has the molecular formula C19H17ClN2O5 and a molecular weight of 388.81 g/mol. Its IUPAC name is [2-[(2R)-3-acetyl-2-(4-methoxyphenyl)-2H-1,3,4-oxadiazol-5-yl]-4-chlorophenyl] acetate.
| Compound Name | [2-[(2R)-3-acetyl-2-(4-methoxyphenyl)-2H-1,3,4-oxadiazol-5-yl]-4-chlorophenyl] acetate |
|---|---|
| PubChem CID | 95053147 |
| Molecular Formula | C19H17ClN2O5 |
| Molecular Weight | 388.81 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | [2-[(2R)-3-acetyl-2-(4-methoxyphenyl)-2H-1,3,4-oxadiazol-5-yl]-4-chlorophenyl] acetate |
| SMILES | COc1ccc([C@H]2OC(c3cc(Cl)ccc3OC(C)=O)=NN2C(C)=O)cc1 |
| InChI | InChI=1S/C19H17ClN2O5/c1-11(23)22-19(13-4-7-15(25-3)8-5-13)27-18(21-22)16-10-14(20)6-9-17(16)26-12(2)24/h4-10,19H,1-3H3/t19-/m1/s1 |
| InChIKey | BNHJRMMGLURKFV-LJQANCHMSA-N |
| XLogP | 3.51 |
| TPSA | 77.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.81 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|