C17H14N4O7 — CID 95063907
1-[(2S)-5-(3,5-dinitrophenyl)-2-(4-methoxyphenyl)-2H-1,3,4-oxadiazol-3-yl]ethanone (PubChem CID 95063907) has the molecular formula C17H14N4O7 and a molecular weight of 386.32 g/mol. Its IUPAC name is 1-[(2S)-5-(3,5-dinitrophenyl)-2-(4-methoxyphenyl)-2H-1,3,4-oxadiazol-3-yl]ethanone.
| Compound Name | 1-[(2S)-5-(3,5-dinitrophenyl)-2-(4-methoxyphenyl)-2H-1,3,4-oxadiazol-3-yl]ethanone |
|---|---|
| PubChem CID | 95063907 |
| Molecular Formula | C17H14N4O7 |
| Molecular Weight | 386.32 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | 1-[(2S)-5-(3,5-dinitrophenyl)-2-(4-methoxyphenyl)-2H-1,3,4-oxadiazol-3-yl]ethanone |
| SMILES | COc1ccc([C@@H]2OC(c3cc([N+](=O)[O-])cc([N+](=O)[O-])c3)=NN2C(C)=O)cc1 |
| InChI | InChI=1S/C17H14N4O7/c1-10(22)19-17(11-3-5-15(27-2)6-4-11)28-16(18-19)12-7-13(20(23)24)9-14(8-12)21(25)26/h3-9,17H,1-2H3/t17-/m0/s1 |
| InChIKey | VTJBFQXXQDHHRE-KRWDZBQOSA-N |
| XLogP | 2.75 |
| TPSA | 137.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.32 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|