C23H17N5O10 — CID 98288027
1-[(2S)-2-[4-(2,4-dinitrophenoxy)-3-methoxyphenyl]-5-(4-nitrophenyl)-2H-1,3,4-oxadiazol-3-yl]ethanone (PubChem CID 98288027) has the molecular formula C23H17N5O10 and a molecular weight of 523.41 g/mol. Its IUPAC name is 1-[(2S)-2-[4-(2,4-dinitrophenoxy)-3-methoxyphenyl]-5-(4-nitrophenyl)-2H-1,3,4-oxadiazol-3-yl]ethanone.
| Compound Name | 1-[(2S)-2-[4-(2,4-dinitrophenoxy)-3-methoxyphenyl]-5-(4-nitrophenyl)-2H-1,3,4-oxadiazol-3-yl]ethanone |
|---|---|
| PubChem CID | 98288027 |
| Molecular Formula | C23H17N5O10 |
| Molecular Weight | 523.41 g/mol |
| Exact Mass | 523.10 |
| IUPAC Name | 1-[(2S)-2-[4-(2,4-dinitrophenoxy)-3-methoxyphenyl]-5-(4-nitrophenyl)-2H-1,3,4-oxadiazol-3-yl]ethanone |
| SMILES | COc1cc([C@@H]2OC(c3ccc([N+](=O)[O-])cc3)=NN2C(C)=O)ccc1Oc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H17N5O10/c1-13(29)25-23(38-22(24-25)14-3-6-16(7-4-14)26(30)31)15-5-9-20(21(11-15)36-2)37-19-10-8-17(27(32)33)12-18(19)28(34)35/h3-12,23H,1-2H3/t23-/m0/s1 |
| InChIKey | NYXZZPCHUMNXEI-QHCPKHFHSA-N |
| XLogP | 4.45 |
| TPSA | 189.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.41 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|