C23H17BrN4O8 — CID 98288023
1-[(2R)-5-(3-bromophenyl)-2-[4-(2,4-dinitrophenoxy)-3-methoxyphenyl]-2H-1,3,4-oxadiazol-3-yl]ethanone (PubChem CID 98288023) has the molecular formula C23H17BrN4O8 and a molecular weight of 557.31 g/mol. Its IUPAC name is 1-[(2R)-5-(3-bromophenyl)-2-[4-(2,4-dinitrophenoxy)-3-methoxyphenyl]-2H-1,3,4-oxadiazol-3-yl]ethanone.
| Compound Name | 1-[(2R)-5-(3-bromophenyl)-2-[4-(2,4-dinitrophenoxy)-3-methoxyphenyl]-2H-1,3,4-oxadiazol-3-yl]ethanone |
|---|---|
| PubChem CID | 98288023 |
| Molecular Formula | C23H17BrN4O8 |
| Molecular Weight | 557.31 g/mol |
| Exact Mass | 556.02 |
| IUPAC Name | 1-[(2R)-5-(3-bromophenyl)-2-[4-(2,4-dinitrophenoxy)-3-methoxyphenyl]-2H-1,3,4-oxadiazol-3-yl]ethanone |
| SMILES | COc1cc([C@H]2OC(c3cccc(Br)c3)=NN2C(C)=O)ccc1Oc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H17BrN4O8/c1-13(29)26-23(36-22(25-26)14-4-3-5-16(24)10-14)15-6-8-20(21(11-15)34-2)35-19-9-7-17(27(30)31)12-18(19)28(32)33/h3-12,23H,1-2H3/t23-/m1/s1 |
| InChIKey | RJCACKXHTQNEOX-HSZRJFAPSA-N |
| XLogP | 5.31 |
| TPSA | 146.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.31 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|