C18H16BrN3O6 — CID 92712864
1-[(2S)-2-(3-bromophenyl)-5-(4,5-dimethoxy-2-nitrophenyl)-2H-1,3,4-oxadiazol-3-yl]ethanone (PubChem CID 92712864) has the molecular formula C18H16BrN3O6 and a molecular weight of 450.25 g/mol. Its IUPAC name is 1-[(2S)-2-(3-bromophenyl)-5-(4,5-dimethoxy-2-nitrophenyl)-2H-1,3,4-oxadiazol-3-yl]ethanone.
| Compound Name | 1-[(2S)-2-(3-bromophenyl)-5-(4,5-dimethoxy-2-nitrophenyl)-2H-1,3,4-oxadiazol-3-yl]ethanone |
|---|---|
| PubChem CID | 92712864 |
| Molecular Formula | C18H16BrN3O6 |
| Molecular Weight | 450.25 g/mol |
| Exact Mass | 449.02 |
| IUPAC Name | 1-[(2S)-2-(3-bromophenyl)-5-(4,5-dimethoxy-2-nitrophenyl)-2H-1,3,4-oxadiazol-3-yl]ethanone |
| SMILES | COc1cc(C2=NN(C(C)=O)[C@H](c3cccc(Br)c3)O2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C18H16BrN3O6/c1-10(23)21-18(11-5-4-6-12(19)7-11)28-17(20-21)13-8-15(26-2)16(27-3)9-14(13)22(24)25/h4-9,18H,1-3H3/t18-/m0/s1 |
| InChIKey | XPVXFAJINUGJIB-SFHVURJKSA-N |
| XLogP | 3.61 |
| TPSA | 103.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.25 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|