C18H15BrN4O7 — CID 92712878
[4-[(2S)-3-acetyl-2-(5-bromo-3-pyridinyl)-2H-1,3,4-oxadiazol-5-yl]-2-methoxy-6-nitrophenyl] acetate (PubChem CID 92712878) has the molecular formula C18H15BrN4O7 and a molecular weight of 479.24 g/mol. Its IUPAC name is [4-[(2S)-3-acetyl-2-(5-bromo-3-pyridinyl)-2H-1,3,4-oxadiazol-5-yl]-2-methoxy-6-nitrophenyl] acetate.
| Compound Name | [4-[(2S)-3-acetyl-2-(5-bromo-3-pyridinyl)-2H-1,3,4-oxadiazol-5-yl]-2-methoxy-6-nitrophenyl] acetate |
|---|---|
| PubChem CID | 92712878 |
| Molecular Formula | C18H15BrN4O7 |
| Molecular Weight | 479.24 g/mol |
| Exact Mass | 478.01 |
| IUPAC Name | [4-[(2S)-3-acetyl-2-(5-bromo-3-pyridinyl)-2H-1,3,4-oxadiazol-5-yl]-2-methoxy-6-nitrophenyl] acetate |
| SMILES | COc1cc(C2=NN(C(C)=O)[C@H](c3cncc(Br)c3)O2)cc([N+](=O)[O-])c1OC(C)=O |
| InChI | InChI=1S/C18H15BrN4O7/c1-9(24)22-18(12-4-13(19)8-20-7-12)30-17(21-22)11-5-14(23(26)27)16(29-10(2)25)15(6-11)28-3/h4-8,18H,1-3H3/t18-/m0/s1 |
| InChIKey | UADMVFIVSRSDJD-SFHVURJKSA-N |
| XLogP | 2.93 |
| TPSA | 133.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.24 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|