C22H26N2O8 — CID 41134614
1-[(2S)-2,5-bis(3,4,5-trimethoxyphenyl)-2H-1,3,4-oxadiazol-3-yl]ethanone (PubChem CID 41134614) has the molecular formula C22H26N2O8 and a molecular weight of 446.46 g/mol. Its IUPAC name is 1-[(2S)-2,5-bis(3,4,5-trimethoxyphenyl)-2H-1,3,4-oxadiazol-3-yl]ethanone.
| Compound Name | 1-[(2S)-2,5-bis(3,4,5-trimethoxyphenyl)-2H-1,3,4-oxadiazol-3-yl]ethanone |
|---|---|
| PubChem CID | 41134614 |
| Molecular Formula | C22H26N2O8 |
| Molecular Weight | 446.46 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | 1-[(2S)-2,5-bis(3,4,5-trimethoxyphenyl)-2H-1,3,4-oxadiazol-3-yl]ethanone |
| SMILES | COc1cc(C2=NN(C(C)=O)[C@H](c3cc(OC)c(OC)c(OC)c3)O2)cc(OC)c1OC |
| InChI | InChI=1S/C22H26N2O8/c1-12(25)24-22(14-10-17(28-4)20(31-7)18(11-14)29-5)32-21(23-24)13-8-15(26-2)19(30-6)16(9-13)27-3/h8-11,22H,1-7H3/t22-/m0/s1 |
| InChIKey | MQNUQTPEQADAKH-QFIPXVFZSA-N |
| XLogP | 2.98 |
| TPSA | 97.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.46 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |