C28H23N3O5 — CID 92751883
[4-[(2S)-3-acetyl-5-(2-phenylquinolin-4-yl)-2H-1,3,4-oxadiazol-2-yl]-2-methoxyphenyl] acetate (PubChem CID 92751883) has the molecular formula C28H23N3O5 and a molecular weight of 481.51 g/mol. Its IUPAC name is [4-[(2S)-3-acetyl-5-(2-phenylquinolin-4-yl)-2H-1,3,4-oxadiazol-2-yl]-2-methoxyphenyl] acetate.
| Compound Name | [4-[(2S)-3-acetyl-5-(2-phenylquinolin-4-yl)-2H-1,3,4-oxadiazol-2-yl]-2-methoxyphenyl] acetate |
|---|---|
| PubChem CID | 92751883 |
| Molecular Formula | C28H23N3O5 |
| Molecular Weight | 481.51 g/mol |
| Exact Mass | 481.16 |
| IUPAC Name | [4-[(2S)-3-acetyl-5-(2-phenylquinolin-4-yl)-2H-1,3,4-oxadiazol-2-yl]-2-methoxyphenyl] acetate |
| SMILES | COc1cc([C@@H]2OC(c3cc(-c4ccccc4)nc4ccccc34)=NN2C(C)=O)ccc1OC(C)=O |
| InChI | InChI=1S/C28H23N3O5/c1-17(32)31-28(20-13-14-25(35-18(2)33)26(15-20)34-3)36-27(30-31)22-16-24(19-9-5-4-6-10-19)29-23-12-8-7-11-21(22)23/h4-16,28H,1-3H3/t28-/m0/s1 |
| InChIKey | DLRHMCMMOWORLJ-NDEPHWFRSA-N |
| XLogP | 5.07 |
| TPSA | 90.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.51 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|