C19H16BrN7O6 — CID 98222025
[2-[(2S)-3-acetyl-2-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)-2H-1,3,4-oxadiazol-5-yl]-4-bromo-6-nitrophenyl] acetate (PubChem CID 98222025) has the molecular formula C19H16BrN7O6 and a molecular weight of 518.28 g/mol. Its IUPAC name is [2-[(2S)-3-acetyl-2-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)-2H-1,3,4-oxadiazol-5-yl]-4-bromo-6-nitrophenyl] acetate.
| Compound Name | [2-[(2S)-3-acetyl-2-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)-2H-1,3,4-oxadiazol-5-yl]-4-bromo-6-nitrophenyl] acetate |
|---|---|
| PubChem CID | 98222025 |
| Molecular Formula | C19H16BrN7O6 |
| Molecular Weight | 518.28 g/mol |
| Exact Mass | 517.03 |
| IUPAC Name | [2-[(2S)-3-acetyl-2-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)-2H-1,3,4-oxadiazol-5-yl]-4-bromo-6-nitrophenyl] acetate |
| SMILES | CC(=O)Oc1c(C2=NN(C(C)=O)[C@H](c3nc4nc(C)cc(C)n4n3)O2)cc(Br)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H16BrN7O6/c1-8-5-9(2)25-19(21-8)22-16(23-25)18-26(10(3)28)24-17(33-18)13-6-12(20)7-14(27(30)31)15(13)32-11(4)29/h5-7,18H,1-4H3/t18-/m0/s1 |
| InChIKey | ZGSXBUZYAQWBIP-SFHVURJKSA-N |
| XLogP | 2.58 |
| TPSA | 154.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.28 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|