C23H19N3O7 — CID 46352321
[2-(3-acetyl-2-naphthalen-1-yl-2H-1,3,4-oxadiazol-5-yl)-6-methoxy-4-nitrophenyl] acetate (PubChem CID 46352321) has the molecular formula C23H19N3O7 and a molecular weight of 449.42 g/mol. Its IUPAC name is [2-(3-acetyl-2-naphthalen-1-yl-2H-1,3,4-oxadiazol-5-yl)-6-methoxy-4-nitrophenyl] acetate.
| Compound Name | [2-(3-acetyl-2-naphthalen-1-yl-2H-1,3,4-oxadiazol-5-yl)-6-methoxy-4-nitrophenyl] acetate |
|---|---|
| PubChem CID | 46352321 |
| Molecular Formula | C23H19N3O7 |
| Molecular Weight | 449.42 g/mol |
| Exact Mass | 449.12 |
| IUPAC Name | [2-(3-acetyl-2-naphthalen-1-yl-2H-1,3,4-oxadiazol-5-yl)-6-methoxy-4-nitrophenyl] acetate |
| SMILES | COc1cc([N+](=O)[O-])cc(C2=NN(C(C)=O)C(c3cccc4ccccc34)O2)c1OC(C)=O |
| InChI | InChI=1S/C23H19N3O7/c1-13(27)25-23(18-10-6-8-15-7-4-5-9-17(15)18)33-22(24-25)19-11-16(26(29)30)12-20(31-3)21(19)32-14(2)28/h4-12,23H,1-3H3 |
| InChIKey | KDWLFQGTCQHNFZ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 120.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.42 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|