C18H13Cl2N3O6 — CID 92712691
[2-[(2S)-3-acetyl-5-(3-nitrophenyl)-2H-1,3,4-oxadiazol-2-yl]-4,6-dichlorophenyl] acetate (PubChem CID 92712691) has the molecular formula C18H13Cl2N3O6 and a molecular weight of 438.22 g/mol. Its IUPAC name is [2-[(2S)-3-acetyl-5-(3-nitrophenyl)-2H-1,3,4-oxadiazol-2-yl]-4,6-dichlorophenyl] acetate.
| Compound Name | [2-[(2S)-3-acetyl-5-(3-nitrophenyl)-2H-1,3,4-oxadiazol-2-yl]-4,6-dichlorophenyl] acetate |
|---|---|
| PubChem CID | 92712691 |
| Molecular Formula | C18H13Cl2N3O6 |
| Molecular Weight | 438.22 g/mol |
| Exact Mass | 437.02 |
| IUPAC Name | [2-[(2S)-3-acetyl-5-(3-nitrophenyl)-2H-1,3,4-oxadiazol-2-yl]-4,6-dichlorophenyl] acetate |
| SMILES | CC(=O)Oc1c(Cl)cc(Cl)cc1[C@@H]1OC(c2cccc([N+](=O)[O-])c2)=NN1C(C)=O |
| InChI | InChI=1S/C18H13Cl2N3O6/c1-9(24)22-18(14-7-12(19)8-15(20)16(14)28-10(2)25)29-17(21-22)11-4-3-5-13(6-11)23(26)27/h3-8,18H,1-2H3/t18-/m0/s1 |
| InChIKey | NDXYUGHKYNNTRK-SFHVURJKSA-N |
| XLogP | 4.07 |
| TPSA | 111.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.22 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|