C20H14N4O7 — CID 95063785
1-[(2S)-5-(3-nitrophenyl)-2-[5-(3-nitrophenyl)furan-2-yl]-2H-1,3,4-oxadiazol-3-yl]ethanone (PubChem CID 95063785) has the molecular formula C20H14N4O7 and a molecular weight of 422.35 g/mol. Its IUPAC name is 1-[(2S)-5-(3-nitrophenyl)-2-[5-(3-nitrophenyl)furan-2-yl]-2H-1,3,4-oxadiazol-3-yl]ethanone.
| Compound Name | 1-[(2S)-5-(3-nitrophenyl)-2-[5-(3-nitrophenyl)furan-2-yl]-2H-1,3,4-oxadiazol-3-yl]ethanone |
|---|---|
| PubChem CID | 95063785 |
| Molecular Formula | C20H14N4O7 |
| Molecular Weight | 422.35 g/mol |
| Exact Mass | 422.09 |
| IUPAC Name | 1-[(2S)-5-(3-nitrophenyl)-2-[5-(3-nitrophenyl)furan-2-yl]-2H-1,3,4-oxadiazol-3-yl]ethanone |
| SMILES | CC(=O)N1N=C(c2cccc([N+](=O)[O-])c2)O[C@H]1c1ccc(-c2cccc([N+](=O)[O-])c2)o1 |
| InChI | InChI=1S/C20H14N4O7/c1-12(25)22-20(31-19(21-22)14-5-3-7-16(11-14)24(28)29)18-9-8-17(30-18)13-4-2-6-15(10-13)23(26)27/h2-11,20H,1H3/t20-/m0/s1 |
| InChIKey | JUABQXBMNUROPO-FQEVSTJZSA-N |
| XLogP | 4.00 |
| TPSA | 141.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.35 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|