C20H16ClN3O8 — CID 92712668
[3-[(2S)-3-acetyl-2-(2-chloro-5-nitrophenyl)-2H-1,3,4-oxadiazol-5-yl]-5-acetyloxyphenyl] acetate (PubChem CID 92712668) has the molecular formula C20H16ClN3O8 and a molecular weight of 461.81 g/mol. Its IUPAC name is [3-[(2S)-3-acetyl-2-(2-chloro-5-nitrophenyl)-2H-1,3,4-oxadiazol-5-yl]-5-acetyloxyphenyl] acetate.
| Compound Name | [3-[(2S)-3-acetyl-2-(2-chloro-5-nitrophenyl)-2H-1,3,4-oxadiazol-5-yl]-5-acetyloxyphenyl] acetate |
|---|---|
| PubChem CID | 92712668 |
| Molecular Formula | C20H16ClN3O8 |
| Molecular Weight | 461.81 g/mol |
| Exact Mass | 461.06 |
| IUPAC Name | [3-[(2S)-3-acetyl-2-(2-chloro-5-nitrophenyl)-2H-1,3,4-oxadiazol-5-yl]-5-acetyloxyphenyl] acetate |
| SMILES | CC(=O)Oc1cc(OC(C)=O)cc(C2=NN(C(C)=O)[C@H](c3cc([N+](=O)[O-])ccc3Cl)O2)c1 |
| InChI | InChI=1S/C20H16ClN3O8/c1-10(25)23-20(17-8-14(24(28)29)4-5-18(17)21)32-19(22-23)13-6-15(30-11(2)26)9-16(7-13)31-12(3)27/h4-9,20H,1-3H3/t20-/m0/s1 |
| InChIKey | ULXDZFRSEGLUNU-FQEVSTJZSA-N |
| XLogP | 3.34 |
| TPSA | 137.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.81 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|