C26H22N4O7 — CID 98222639
[2-[(2R)-3-acetyl-5-[4-[(2-methylbenzoyl)amino]phenyl]-2H-1,3,4-oxadiazol-2-yl]-4-nitrophenyl] acetate (PubChem CID 98222639) has the molecular formula C26H22N4O7 and a molecular weight of 502.48 g/mol. Its IUPAC name is [2-[(2R)-3-acetyl-5-[4-[(2-methylbenzoyl)amino]phenyl]-2H-1,3,4-oxadiazol-2-yl]-4-nitrophenyl] acetate.
| Compound Name | [2-[(2R)-3-acetyl-5-[4-[(2-methylbenzoyl)amino]phenyl]-2H-1,3,4-oxadiazol-2-yl]-4-nitrophenyl] acetate |
|---|---|
| PubChem CID | 98222639 |
| Molecular Formula | C26H22N4O7 |
| Molecular Weight | 502.48 g/mol |
| Exact Mass | 502.15 |
| IUPAC Name | [2-[(2R)-3-acetyl-5-[4-[(2-methylbenzoyl)amino]phenyl]-2H-1,3,4-oxadiazol-2-yl]-4-nitrophenyl] acetate |
| SMILES | CC(=O)Oc1ccc([N+](=O)[O-])cc1[C@H]1OC(c2ccc(NC(=O)c3ccccc3C)cc2)=NN1C(C)=O |
| InChI | InChI=1S/C26H22N4O7/c1-15-6-4-5-7-21(15)24(33)27-19-10-8-18(9-11-19)25-28-29(16(2)31)26(37-25)22-14-20(30(34)35)12-13-23(22)36-17(3)32/h4-14,26H,1-3H3,(H,27,33)/t26-/m1/s1 |
| InChIKey | ULMJYYBBVZGAKM-AREMUKBSSA-N |
| XLogP | 4.32 |
| TPSA | 140.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.48 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|