C18H15FN2O4 — CID 850776
[2-[(2R)-3-acetyl-5-(4-fluorophenyl)-2H-1,3,4-oxadiazol-2-yl]phenyl] acetate (PubChem CID 850776) has the molecular formula C18H15FN2O4 and a molecular weight of 342.33 g/mol. Its IUPAC name is [2-[(2R)-3-acetyl-5-(4-fluorophenyl)-2H-1,3,4-oxadiazol-2-yl]phenyl] acetate.
| Compound Name | [2-[(2R)-3-acetyl-5-(4-fluorophenyl)-2H-1,3,4-oxadiazol-2-yl]phenyl] acetate |
|---|---|
| PubChem CID | 850776 |
| Molecular Formula | C18H15FN2O4 |
| Molecular Weight | 342.33 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | [2-[(2R)-3-acetyl-5-(4-fluorophenyl)-2H-1,3,4-oxadiazol-2-yl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccccc1[C@H]1OC(c2ccc(F)cc2)=NN1C(C)=O |
| InChI | InChI=1S/C18H15FN2O4/c1-11(22)21-18(15-5-3-4-6-16(15)24-12(2)23)25-17(20-21)13-7-9-14(19)10-8-13/h3-10,18H,1-2H3/t18-/m1/s1 |
| InChIKey | ZYSJDBSPPLEOFA-GOSISDBHSA-N |
| XLogP | 2.99 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.33 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|