C22H17ClN2O4 — CID 92712995
[1-[(2S)-3-acetyl-2-(2-chlorophenyl)-2H-1,3,4-oxadiazol-5-yl]naphthalen-2-yl] acetate (PubChem CID 92712995) has the molecular formula C22H17ClN2O4 and a molecular weight of 408.84 g/mol. Its IUPAC name is [1-[(2S)-3-acetyl-2-(2-chlorophenyl)-2H-1,3,4-oxadiazol-5-yl]naphthalen-2-yl] acetate.
| Compound Name | [1-[(2S)-3-acetyl-2-(2-chlorophenyl)-2H-1,3,4-oxadiazol-5-yl]naphthalen-2-yl] acetate |
|---|---|
| PubChem CID | 92712995 |
| Molecular Formula | C22H17ClN2O4 |
| Molecular Weight | 408.84 g/mol |
| Exact Mass | 408.09 |
| IUPAC Name | [1-[(2S)-3-acetyl-2-(2-chlorophenyl)-2H-1,3,4-oxadiazol-5-yl]naphthalen-2-yl] acetate |
| SMILES | CC(=O)Oc1ccc2ccccc2c1C1=NN(C(C)=O)[C@H](c2ccccc2Cl)O1 |
| InChI | InChI=1S/C22H17ClN2O4/c1-13(26)25-22(17-9-5-6-10-18(17)23)29-21(24-25)20-16-8-4-3-7-15(16)11-12-19(20)28-14(2)27/h3-12,22H,1-2H3/t22-/m0/s1 |
| InChIKey | TZGHKPCFEACRLJ-QFIPXVFZSA-N |
| XLogP | 4.66 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.84 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|