C21H18N2O5 — CID 92712729
[1-[(2S)-3-acetyl-5-(5-methylfuran-2-yl)-2H-1,3,4-oxadiazol-2-yl]naphthalen-2-yl] acetate (PubChem CID 92712729) has the molecular formula C21H18N2O5 and a molecular weight of 378.38 g/mol. Its IUPAC name is [1-[(2S)-3-acetyl-5-(5-methylfuran-2-yl)-2H-1,3,4-oxadiazol-2-yl]naphthalen-2-yl] acetate.
| Compound Name | [1-[(2S)-3-acetyl-5-(5-methylfuran-2-yl)-2H-1,3,4-oxadiazol-2-yl]naphthalen-2-yl] acetate |
|---|---|
| PubChem CID | 92712729 |
| Molecular Formula | C21H18N2O5 |
| Molecular Weight | 378.38 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | [1-[(2S)-3-acetyl-5-(5-methylfuran-2-yl)-2H-1,3,4-oxadiazol-2-yl]naphthalen-2-yl] acetate |
| SMILES | CC(=O)Oc1ccc2ccccc2c1[C@@H]1OC(c2ccc(C)o2)=NN1C(C)=O |
| InChI | InChI=1S/C21H18N2O5/c1-12-8-10-18(26-12)20-22-23(13(2)24)21(28-20)19-16-7-5-4-6-15(16)9-11-17(19)27-14(3)25/h4-11,21H,1-3H3/t21-/m0/s1 |
| InChIKey | WQOSQENBWLHYLH-NRFANRHFSA-N |
| XLogP | 3.91 |
| TPSA | 81.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.38 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|