C22H20N2O5 — CID 22577284
[1-[3-acetyl-2-(2,5-dimethylfuran-3-yl)-2H-1,3,4-oxadiazol-5-yl]naphthalen-2-yl] acetate (PubChem CID 22577284) has the molecular formula C22H20N2O5 and a molecular weight of 392.41 g/mol. Its IUPAC name is [1-[3-acetyl-2-(2,5-dimethylfuran-3-yl)-2H-1,3,4-oxadiazol-5-yl]naphthalen-2-yl] acetate.
| Compound Name | [1-[3-acetyl-2-(2,5-dimethylfuran-3-yl)-2H-1,3,4-oxadiazol-5-yl]naphthalen-2-yl] acetate |
|---|---|
| PubChem CID | 22577284 |
| Molecular Formula | C22H20N2O5 |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | [1-[3-acetyl-2-(2,5-dimethylfuran-3-yl)-2H-1,3,4-oxadiazol-5-yl]naphthalen-2-yl] acetate |
| SMILES | CC(=O)Oc1ccc2ccccc2c1C1=NN(C(C)=O)C(c2cc(C)oc2C)O1 |
| InChI | InChI=1S/C22H20N2O5/c1-12-11-18(13(2)27-12)22-24(14(3)25)23-21(29-22)20-17-8-6-5-7-16(17)9-10-19(20)28-15(4)26/h5-11,22H,1-4H3 |
| InChIKey | QHQDMYLMDNYQQT-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 81.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|