C30H25N3O5 — CID 92713026
[1-[(2R)-3-acetyl-2-[4-[(3-methylbenzoyl)amino]phenyl]-2H-1,3,4-oxadiazol-5-yl]naphthalen-2-yl] acetate (PubChem CID 92713026) has the molecular formula C30H25N3O5 and a molecular weight of 507.55 g/mol. Its IUPAC name is [1-[(2R)-3-acetyl-2-[4-[(3-methylbenzoyl)amino]phenyl]-2H-1,3,4-oxadiazol-5-yl]naphthalen-2-yl] acetate.
| Compound Name | [1-[(2R)-3-acetyl-2-[4-[(3-methylbenzoyl)amino]phenyl]-2H-1,3,4-oxadiazol-5-yl]naphthalen-2-yl] acetate |
|---|---|
| PubChem CID | 92713026 |
| Molecular Formula | C30H25N3O5 |
| Molecular Weight | 507.55 g/mol |
| Exact Mass | 507.18 |
| IUPAC Name | [1-[(2R)-3-acetyl-2-[4-[(3-methylbenzoyl)amino]phenyl]-2H-1,3,4-oxadiazol-5-yl]naphthalen-2-yl] acetate |
| SMILES | CC(=O)Oc1ccc2ccccc2c1C1=NN(C(C)=O)[C@@H](c2ccc(NC(=O)c3cccc(C)c3)cc2)O1 |
| InChI | InChI=1S/C30H25N3O5/c1-18-7-6-9-23(17-18)28(36)31-24-14-11-22(12-15-24)30-33(19(2)34)32-29(38-30)27-25-10-5-4-8-21(25)13-16-26(27)37-20(3)35/h4-17,30H,1-3H3,(H,31,36)/t30-/m1/s1 |
| InChIKey | HVDFDRWNLYCQMT-SSEXGKCCSA-N |
| XLogP | 5.56 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.55 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|