C27H25N3O6 — CID 46352200
[2-[3-acetyl-5-[4-[(4-methylbenzoyl)amino]phenyl]-2H-1,3,4-oxadiazol-2-yl]-4-methoxyphenyl] acetate (PubChem CID 46352200) has the molecular formula C27H25N3O6 and a molecular weight of 487.51 g/mol. Its IUPAC name is [2-[3-acetyl-5-[4-[(4-methylbenzoyl)amino]phenyl]-2H-1,3,4-oxadiazol-2-yl]-4-methoxyphenyl] acetate.
| Compound Name | [2-[3-acetyl-5-[4-[(4-methylbenzoyl)amino]phenyl]-2H-1,3,4-oxadiazol-2-yl]-4-methoxyphenyl] acetate |
|---|---|
| PubChem CID | 46352200 |
| Molecular Formula | C27H25N3O6 |
| Molecular Weight | 487.51 g/mol |
| Exact Mass | 487.17 |
| IUPAC Name | [2-[3-acetyl-5-[4-[(4-methylbenzoyl)amino]phenyl]-2H-1,3,4-oxadiazol-2-yl]-4-methoxyphenyl] acetate |
| SMILES | COc1ccc(OC(C)=O)c(C2OC(c3ccc(NC(=O)c4ccc(C)cc4)cc3)=NN2C(C)=O)c1 |
| InChI | InChI=1S/C27H25N3O6/c1-16-5-7-19(8-6-16)25(33)28-21-11-9-20(10-12-21)26-29-30(17(2)31)27(36-26)23-15-22(34-4)13-14-24(23)35-18(3)32/h5-15,27H,1-4H3,(H,28,33) |
| InChIKey | UEFCEKHPAUBUSJ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 106.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.51 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|