C18H17N3O6 — CID 92715525
1-[(2S)-5-[(4-methoxyphenoxy)methyl]-2-(3-nitrophenyl)-2H-1,3,4-oxadiazol-3-yl]ethanone (PubChem CID 92715525) has the molecular formula C18H17N3O6 and a molecular weight of 371.35 g/mol. Its IUPAC name is 1-[(2S)-5-[(4-methoxyphenoxy)methyl]-2-(3-nitrophenyl)-2H-1,3,4-oxadiazol-3-yl]ethanone.
| Compound Name | 1-[(2S)-5-[(4-methoxyphenoxy)methyl]-2-(3-nitrophenyl)-2H-1,3,4-oxadiazol-3-yl]ethanone |
|---|---|
| PubChem CID | 92715525 |
| Molecular Formula | C18H17N3O6 |
| Molecular Weight | 371.35 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | 1-[(2S)-5-[(4-methoxyphenoxy)methyl]-2-(3-nitrophenyl)-2H-1,3,4-oxadiazol-3-yl]ethanone |
| SMILES | COc1ccc(OCC2=NN(C(C)=O)[C@H](c3cccc([N+](=O)[O-])c3)O2)cc1 |
| InChI | InChI=1S/C18H17N3O6/c1-12(22)20-18(13-4-3-5-14(10-13)21(23)24)27-17(19-20)11-26-16-8-6-15(25-2)7-9-16/h3-10,18H,11H2,1-2H3/t18-/m0/s1 |
| InChIKey | GBSLLKLETFLYRD-SFHVURJKSA-N |
| XLogP | 2.87 |
| TPSA | 103.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.35 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|