C17H15N3O4 — CID 71525299
[4-(3-acetyl-5-pyridin-4-yl-2H-1,3,4-oxadiazol-2-yl)phenyl] acetate (PubChem CID 71525299) has the molecular formula C17H15N3O4 and a molecular weight of 325.32 g/mol. Its IUPAC name is [4-(3-acetyl-5-pyridin-4-yl-2H-1,3,4-oxadiazol-2-yl)phenyl] acetate.
| Compound Name | [4-(3-acetyl-5-pyridin-4-yl-2H-1,3,4-oxadiazol-2-yl)phenyl] acetate |
|---|---|
| PubChem CID | 71525299 |
| Molecular Formula | C17H15N3O4 |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | [4-(3-acetyl-5-pyridin-4-yl-2H-1,3,4-oxadiazol-2-yl)phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(C2OC(c3ccncc3)=NN2C(C)=O)cc1 |
| InChI | InChI=1S/C17H15N3O4/c1-11(21)20-17(14-3-5-15(6-4-14)23-12(2)22)24-16(19-20)13-7-9-18-10-8-13/h3-10,17H,1-2H3 |
| InChIKey | PAMFGYACFMOAFE-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 81.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|