C21H24N3O4S+ — CID 7480196
3-[(6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-2-ium-2-yl)methyl]-5-(4-methoxyphenyl)-1,3,4-oxadiazole-2-thione (PubChem CID 7480196) has the molecular formula C21H24N3O4S+ and a molecular weight of 414.51 g/mol. Its IUPAC name is 3-[(6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-2-ium-2-yl)methyl]-5-(4-methoxyphenyl)-1,3,4-oxadiazole-2-thione.
| Compound Name | 3-[(6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-2-ium-2-yl)methyl]-5-(4-methoxyphenyl)-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 7480196 |
| Molecular Formula | C21H24N3O4S+ |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | 3-[(6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-2-ium-2-yl)methyl]-5-(4-methoxyphenyl)-1,3,4-oxadiazole-2-thione |
| SMILES | COc1ccc(-c2nn(C[NH+]3CCc4cc(OC)c(OC)cc4C3)c(=S)o2)cc1 |
| InChI | InChI=1S/C21H23N3O4S/c1-25-17-6-4-14(5-7-17)20-22-24(21(29)28-20)13-23-9-8-15-10-18(26-2)19(27-3)11-16(15)12-23/h4-7,10-11H,8-9,12-13H2,1-3H3/p+1 |
| InChIKey | LUQKMPHKKWQHQV-UHFFFAOYSA-O |
| XLogP | 2.50 |
| TPSA | 63.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|