C20H25N5O3S+2 — CID 9243458
5-(2,4-dimethoxyphenyl)-3-[(4-pyridin-1-ium-2-ylpiperazin-1-ium-1-yl)methyl]-1,3,4-oxadiazole-2-thione (PubChem CID 9243458) has the molecular formula C20H25N5O3S+2 and a molecular weight of 415.52 g/mol. Its IUPAC name is 5-(2,4-dimethoxyphenyl)-3-[(4-pyridin-1-ium-2-ylpiperazin-1-ium-1-yl)methyl]-1,3,4-oxadiazole-2-thione.
| Compound Name | 5-(2,4-dimethoxyphenyl)-3-[(4-pyridin-1-ium-2-ylpiperazin-1-ium-1-yl)methyl]-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 9243458 |
| Molecular Formula | C20H25N5O3S+2 |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | 5-(2,4-dimethoxyphenyl)-3-[(4-pyridin-1-ium-2-ylpiperazin-1-ium-1-yl)methyl]-1,3,4-oxadiazole-2-thione |
| SMILES | COc1ccc(-c2nn(C[NH+]3CCN(c4cccc[nH+]4)CC3)c(=S)o2)c(OC)c1 |
| InChI | InChI=1S/C20H23N5O3S/c1-26-15-6-7-16(17(13-15)27-2)19-22-25(20(29)28-19)14-23-9-11-24(12-10-23)18-5-3-4-8-21-18/h3-8,13H,9-12,14H2,1-2H3/p+2 |
| InChIKey | NMURDOQCXDDKBF-UHFFFAOYSA-P |
| XLogP | 1.07 |
| TPSA | 71.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|