C18H20N5OS+ — CID 2393424
3-[(4-phenylpiperazin-1-ium-1-yl)methyl]-5-pyridin-4-yl-1,3,4-oxadiazole-2-thione (PubChem CID 2393424) has the molecular formula C18H20N5OS+ and a molecular weight of 354.46 g/mol. Its IUPAC name is 3-[(4-phenylpiperazin-1-ium-1-yl)methyl]-5-pyridin-4-yl-1,3,4-oxadiazole-2-thione.
| Compound Name | 3-[(4-phenylpiperazin-1-ium-1-yl)methyl]-5-pyridin-4-yl-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 2393424 |
| Molecular Formula | C18H20N5OS+ |
| Molecular Weight | 354.46 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | 3-[(4-phenylpiperazin-1-ium-1-yl)methyl]-5-pyridin-4-yl-1,3,4-oxadiazole-2-thione |
| SMILES | S=c1oc(-c2ccncc2)nn1C[NH+]1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C18H19N5OS/c25-18-23(20-17(24-18)15-6-8-19-9-7-15)14-21-10-12-22(13-11-21)16-4-2-1-3-5-16/h1-9H,10-14H2/p+1 |
| InChIKey | BYQYVIGUOJDGIT-UHFFFAOYSA-O |
| XLogP | 1.63 |
| TPSA | 51.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.46 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|