C14H17BrN3OS+ — CID 7385856
5-(2-bromophenyl)-3-(piperidin-1-ium-1-ylmethyl)-1,3,4-oxadiazole-2-thione (PubChem CID 7385856) has the molecular formula C14H17BrN3OS+ and a molecular weight of 355.28 g/mol. Its IUPAC name is 5-(2-bromophenyl)-3-(piperidin-1-ium-1-ylmethyl)-1,3,4-oxadiazole-2-thione.
| Compound Name | 5-(2-bromophenyl)-3-(piperidin-1-ium-1-ylmethyl)-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 7385856 |
| Molecular Formula | C14H17BrN3OS+ |
| Molecular Weight | 355.28 g/mol |
| Exact Mass | 354.03 |
| IUPAC Name | 5-(2-bromophenyl)-3-(piperidin-1-ium-1-ylmethyl)-1,3,4-oxadiazole-2-thione |
| SMILES | S=c1oc(-c2ccccc2Br)nn1C[NH+]1CCCCC1 |
| InChI | InChI=1S/C14H16BrN3OS/c15-12-7-3-2-6-11(12)13-16-18(14(20)19-13)10-17-8-4-1-5-9-17/h2-3,6-7H,1,4-5,8-10H2/p+1 |
| InChIKey | RDZJNLKTGZCYMX-UHFFFAOYSA-O |
| XLogP | 2.66 |
| TPSA | 35.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.28 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|