C22H31N4O2S+ — CID 9320064
azepan-1-yl-[1-[(5-benzyl-2-sulfanylidene-1,3,4-oxadiazol-3-yl)methyl]piperidin-1-ium-4-yl]methanone (PubChem CID 9320064) has the molecular formula C22H31N4O2S+ and a molecular weight of 415.58 g/mol. Its IUPAC name is azepan-1-yl-[1-[(5-benzyl-2-sulfanylidene-1,3,4-oxadiazol-3-yl)methyl]piperidin-1-ium-4-yl]methanone.
| Compound Name | azepan-1-yl-[1-[(5-benzyl-2-sulfanylidene-1,3,4-oxadiazol-3-yl)methyl]piperidin-1-ium-4-yl]methanone |
|---|---|
| PubChem CID | 9320064 |
| Molecular Formula | C22H31N4O2S+ |
| Molecular Weight | 415.58 g/mol |
| Exact Mass | 415.22 |
| IUPAC Name | azepan-1-yl-[1-[(5-benzyl-2-sulfanylidene-1,3,4-oxadiazol-3-yl)methyl]piperidin-1-ium-4-yl]methanone |
| SMILES | O=C(C1CC[NH+](Cn2nc(Cc3ccccc3)oc2=S)CC1)N1CCCCCC1 |
| InChI | InChI=1S/C22H30N4O2S/c27-21(25-12-6-1-2-7-13-25)19-10-14-24(15-11-19)17-26-22(29)28-20(23-26)16-18-8-4-3-5-9-18/h3-5,8-9,19H,1-2,6-7,10-17H2/p+1 |
| InChIKey | INHYNPZRACPYDV-UHFFFAOYSA-O |
| XLogP | 2.45 |
| TPSA | 55.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.58 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|