C19H18N3O3S+ — CID 2635943
5-(1,3-benzodioxol-5-yl)-3-(1,2,3,4-tetrahydroisoquinolin-2-ium-2-ylmethyl)-1,3,4-oxadiazole-2-thione (PubChem CID 2635943) has the molecular formula C19H18N3O3S+ and a molecular weight of 368.44 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-yl)-3-(1,2,3,4-tetrahydroisoquinolin-2-ium-2-ylmethyl)-1,3,4-oxadiazole-2-thione.
| Compound Name | 5-(1,3-benzodioxol-5-yl)-3-(1,2,3,4-tetrahydroisoquinolin-2-ium-2-ylmethyl)-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 2635943 |
| Molecular Formula | C19H18N3O3S+ |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | 5-(1,3-benzodioxol-5-yl)-3-(1,2,3,4-tetrahydroisoquinolin-2-ium-2-ylmethyl)-1,3,4-oxadiazole-2-thione |
| SMILES | S=c1oc(-c2ccc3c(c2)OCO3)nn1C[NH+]1CCc2ccccc2C1 |
| InChI | InChI=1S/C19H17N3O3S/c26-19-22(11-21-8-7-13-3-1-2-4-15(13)10-21)20-18(25-19)14-5-6-16-17(9-14)24-12-23-16/h1-6,9H,7-8,10-12H2/p+1 |
| InChIKey | QLQQROAXHYMPKS-UHFFFAOYSA-O |
| XLogP | 2.20 |
| TPSA | 53.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|