C18H16ClN3O3S — CID 27080878
5-(1,3-benzodioxol-5-yl)-3-[[(4-chlorophenyl)methyl-methylamino]methyl]-1,3,4-oxadiazole-2-thione (PubChem CID 27080878) has the molecular formula C18H16ClN3O3S and a molecular weight of 389.86 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-yl)-3-[[(4-chlorophenyl)methyl-methylamino]methyl]-1,3,4-oxadiazole-2-thione.
| Compound Name | 5-(1,3-benzodioxol-5-yl)-3-[[(4-chlorophenyl)methyl-methylamino]methyl]-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 27080878 |
| Molecular Formula | C18H16ClN3O3S |
| Molecular Weight | 389.86 g/mol |
| Exact Mass | 389.06 |
| IUPAC Name | 5-(1,3-benzodioxol-5-yl)-3-[[(4-chlorophenyl)methyl-methylamino]methyl]-1,3,4-oxadiazole-2-thione |
| SMILES | CN(Cc1ccc(Cl)cc1)Cn1nc(-c2ccc3c(c2)OCO3)oc1=S |
| InChI | InChI=1S/C18H16ClN3O3S/c1-21(9-12-2-5-14(19)6-3-12)10-22-18(26)25-17(20-22)13-4-7-15-16(8-13)24-11-23-15/h2-8H,9-11H2,1H3 |
| InChIKey | XNMWPRBXUVXSQS-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 52.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.86 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|