C21H24N4O4S2 — CID 2375552
3-[[benzyl(methyl)amino]methyl]-5-(3-morpholin-4-ylsulfonylphenyl)-1,3,4-oxadiazole-2-thione (PubChem CID 2375552) has the molecular formula C21H24N4O4S2 and a molecular weight of 460.58 g/mol. Its IUPAC name is 3-[[benzyl(methyl)amino]methyl]-5-(3-morpholin-4-ylsulfonylphenyl)-1,3,4-oxadiazole-2-thione.
| Compound Name | 3-[[benzyl(methyl)amino]methyl]-5-(3-morpholin-4-ylsulfonylphenyl)-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 2375552 |
| Molecular Formula | C21H24N4O4S2 |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.12 |
| IUPAC Name | 3-[[benzyl(methyl)amino]methyl]-5-(3-morpholin-4-ylsulfonylphenyl)-1,3,4-oxadiazole-2-thione |
| SMILES | CN(Cc1ccccc1)Cn1nc(-c2cccc(S(=O)(=O)N3CCOCC3)c2)oc1=S |
| InChI | InChI=1S/C21H24N4O4S2/c1-23(15-17-6-3-2-4-7-17)16-25-21(30)29-20(22-25)18-8-5-9-19(14-18)31(26,27)24-10-12-28-13-11-24/h2-9,14H,10-13,15-16H2,1H3 |
| InChIKey | VQVRCLPFZIYYNF-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 80.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|