C19H22N4O2S2 — CID 27393478
3-[[methyl-[(4-morpholin-4-ylphenyl)methyl]amino]methyl]-5-thiophen-2-yl-1,3,4-oxadiazole-2-thione (PubChem CID 27393478) has the molecular formula C19H22N4O2S2 and a molecular weight of 402.55 g/mol. Its IUPAC name is 3-[[methyl-[(4-morpholin-4-ylphenyl)methyl]amino]methyl]-5-thiophen-2-yl-1,3,4-oxadiazole-2-thione.
| Compound Name | 3-[[methyl-[(4-morpholin-4-ylphenyl)methyl]amino]methyl]-5-thiophen-2-yl-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 27393478 |
| Molecular Formula | C19H22N4O2S2 |
| Molecular Weight | 402.55 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | 3-[[methyl-[(4-morpholin-4-ylphenyl)methyl]amino]methyl]-5-thiophen-2-yl-1,3,4-oxadiazole-2-thione |
| SMILES | CN(Cc1ccc(N2CCOCC2)cc1)Cn1nc(-c2cccs2)oc1=S |
| InChI | InChI=1S/C19H22N4O2S2/c1-21(14-23-19(26)25-18(20-23)17-3-2-12-27-17)13-15-4-6-16(7-5-15)22-8-10-24-11-9-22/h2-7,12H,8-11,13-14H2,1H3 |
| InChIKey | VKZQTKJDIDRGRS-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 46.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.55 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|