C23H28N4O3S — CID 27393618
5-[(4-methoxyphenyl)methyl]-3-[[methyl-[(4-morpholin-4-ylphenyl)methyl]amino]methyl]-1,3,4-oxadiazole-2-thione (PubChem CID 27393618) has the molecular formula C23H28N4O3S and a molecular weight of 440.57 g/mol. Its IUPAC name is 5-[(4-methoxyphenyl)methyl]-3-[[methyl-[(4-morpholin-4-ylphenyl)methyl]amino]methyl]-1,3,4-oxadiazole-2-thione.
| Compound Name | 5-[(4-methoxyphenyl)methyl]-3-[[methyl-[(4-morpholin-4-ylphenyl)methyl]amino]methyl]-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 27393618 |
| Molecular Formula | C23H28N4O3S |
| Molecular Weight | 440.57 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | 5-[(4-methoxyphenyl)methyl]-3-[[methyl-[(4-morpholin-4-ylphenyl)methyl]amino]methyl]-1,3,4-oxadiazole-2-thione |
| SMILES | COc1ccc(Cc2nn(CN(C)Cc3ccc(N4CCOCC4)cc3)c(=S)o2)cc1 |
| InChI | InChI=1S/C23H28N4O3S/c1-25(16-19-3-7-20(8-4-19)26-11-13-29-14-12-26)17-27-23(31)30-22(24-27)15-18-5-9-21(28-2)10-6-18/h3-10H,11-17H2,1-2H3 |
| InChIKey | WLIQSTGWNJOIFA-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.57 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|