C17H19N3O3S2 — CID 9319134
5-(3,5-dimethoxyphenyl)-3-[[methyl(thiophen-3-ylmethyl)amino]methyl]-1,3,4-oxadiazole-2-thione (PubChem CID 9319134) has the molecular formula C17H19N3O3S2 and a molecular weight of 377.49 g/mol. Its IUPAC name is 5-(3,5-dimethoxyphenyl)-3-[[methyl(thiophen-3-ylmethyl)amino]methyl]-1,3,4-oxadiazole-2-thione.
| Compound Name | 5-(3,5-dimethoxyphenyl)-3-[[methyl(thiophen-3-ylmethyl)amino]methyl]-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 9319134 |
| Molecular Formula | C17H19N3O3S2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | 5-(3,5-dimethoxyphenyl)-3-[[methyl(thiophen-3-ylmethyl)amino]methyl]-1,3,4-oxadiazole-2-thione |
| SMILES | COc1cc(OC)cc(-c2nn(CN(C)Cc3ccsc3)c(=S)o2)c1 |
| InChI | InChI=1S/C17H19N3O3S2/c1-19(9-12-4-5-25-10-12)11-20-17(24)23-16(18-20)13-6-14(21-2)8-15(7-13)22-3/h4-8,10H,9,11H2,1-3H3 |
| InChIKey | DUVYCHZUJUNWEB-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 52.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|