C14H15N5S2 — CID 9318591
1-[[methyl(thiophen-3-ylmethyl)amino]methyl]-4-phenyltetrazole-5-thione (PubChem CID 9318591) has the molecular formula C14H15N5S2 and a molecular weight of 317.44 g/mol. Its IUPAC name is 1-[[methyl(thiophen-3-ylmethyl)amino]methyl]-4-phenyltetrazole-5-thione.
| Compound Name | 1-[[methyl(thiophen-3-ylmethyl)amino]methyl]-4-phenyltetrazole-5-thione |
|---|---|
| PubChem CID | 9318591 |
| Molecular Formula | C14H15N5S2 |
| Molecular Weight | 317.44 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | 1-[[methyl(thiophen-3-ylmethyl)amino]methyl]-4-phenyltetrazole-5-thione |
| SMILES | CN(Cc1ccsc1)Cn1nnn(-c2ccccc2)c1=S |
| InChI | InChI=1S/C14H15N5S2/c1-17(9-12-7-8-21-10-12)11-18-14(20)19(16-15-18)13-5-3-2-4-6-13/h2-8,10H,9,11H2,1H3 |
| InChIKey | GSSQKHZGZDAPHL-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 38.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.44 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|