C19H20N8S — CID 9284918
1-[[methyl-[(1S)-1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]amino]methyl]-4-phenyltetrazole-5-thione (PubChem CID 9284918) has the molecular formula C19H20N8S and a molecular weight of 392.49 g/mol. Its IUPAC name is 1-[[methyl-[(1S)-1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]amino]methyl]-4-phenyltetrazole-5-thione.
| Compound Name | 1-[[methyl-[(1S)-1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]amino]methyl]-4-phenyltetrazole-5-thione |
|---|---|
| PubChem CID | 9284918 |
| Molecular Formula | C19H20N8S |
| Molecular Weight | 392.49 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | 1-[[methyl-[(1S)-1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]amino]methyl]-4-phenyltetrazole-5-thione |
| SMILES | C[C@@H](c1ccc(-n2cncn2)cc1)N(C)Cn1nnn(-c2ccccc2)c1=S |
| InChI | InChI=1S/C19H20N8S/c1-15(16-8-10-17(11-9-16)25-13-20-12-21-25)24(2)14-26-19(28)27(23-22-26)18-6-4-3-5-7-18/h3-13,15H,14H2,1-2H3/t15-/m0/s1 |
| InChIKey | OMZWQBBDNRRTNU-HNNXBMFYSA-N |
| XLogP | 3.03 |
| TPSA | 69.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.49 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|