C20H23N5S2 — CID 9098369
1-methyl-3-(2-phenylsulfanylethyl)-1-[(1R)-1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]thiourea (PubChem CID 9098369) has the molecular formula C20H23N5S2 and a molecular weight of 397.57 g/mol. Its IUPAC name is 1-methyl-3-(2-phenylsulfanylethyl)-1-[(1R)-1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]thiourea.
| Compound Name | 1-methyl-3-(2-phenylsulfanylethyl)-1-[(1R)-1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]thiourea |
|---|---|
| PubChem CID | 9098369 |
| Molecular Formula | C20H23N5S2 |
| Molecular Weight | 397.57 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | 1-methyl-3-(2-phenylsulfanylethyl)-1-[(1R)-1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]thiourea |
| SMILES | C[C@H](c1ccc(-n2cncn2)cc1)N(C)C(=S)NCCSc1ccccc1 |
| InChI | InChI=1S/C20H23N5S2/c1-16(17-8-10-18(11-9-17)25-15-21-14-23-25)24(2)20(26)22-12-13-27-19-6-4-3-5-7-19/h3-11,14-16H,12-13H2,1-2H3,(H,22,26)/t16-/m1/s1 |
| InChIKey | DNHXMFZENORPHS-MRXNPFEDSA-N |
| XLogP | 3.93 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.57 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|