C18H23N3O2S3 — CID 9283811
1-methyl-3-(2-phenylsulfanylethyl)-1-[(1R)-1-(4-sulfamoylphenyl)ethyl]thiourea (PubChem CID 9283811) has the molecular formula C18H23N3O2S3 and a molecular weight of 409.60 g/mol. Its IUPAC name is 1-methyl-3-(2-phenylsulfanylethyl)-1-[(1R)-1-(4-sulfamoylphenyl)ethyl]thiourea.
| Compound Name | 1-methyl-3-(2-phenylsulfanylethyl)-1-[(1R)-1-(4-sulfamoylphenyl)ethyl]thiourea |
|---|---|
| PubChem CID | 9283811 |
| Molecular Formula | C18H23N3O2S3 |
| Molecular Weight | 409.60 g/mol |
| Exact Mass | 409.10 |
| IUPAC Name | 1-methyl-3-(2-phenylsulfanylethyl)-1-[(1R)-1-(4-sulfamoylphenyl)ethyl]thiourea |
| SMILES | C[C@H](c1ccc(S(N)(=O)=O)cc1)N(C)C(=S)NCCSc1ccccc1 |
| InChI | InChI=1S/C18H23N3O2S3/c1-14(15-8-10-17(11-9-15)26(19,22)23)21(2)18(24)20-12-13-25-16-6-4-3-5-7-16/h3-11,14H,12-13H2,1-2H3,(H,20,24)(H2,19,22,23)/t14-/m1/s1 |
| InChIKey | OGLQOPDKKPDMEA-CQSZACIVSA-N |
| XLogP | 2.99 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.60 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|