C20H27N3O2S2 — CID 9215616
3-(4-butylphenyl)-1-methyl-1-[(1R)-1-(4-sulfamoylphenyl)ethyl]thiourea (PubChem CID 9215616) has the molecular formula C20H27N3O2S2 and a molecular weight of 405.59 g/mol. Its IUPAC name is 3-(4-butylphenyl)-1-methyl-1-[(1R)-1-(4-sulfamoylphenyl)ethyl]thiourea.
| Compound Name | 3-(4-butylphenyl)-1-methyl-1-[(1R)-1-(4-sulfamoylphenyl)ethyl]thiourea |
|---|---|
| PubChem CID | 9215616 |
| Molecular Formula | C20H27N3O2S2 |
| Molecular Weight | 405.59 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | 3-(4-butylphenyl)-1-methyl-1-[(1R)-1-(4-sulfamoylphenyl)ethyl]thiourea |
| SMILES | CCCCc1ccc(NC(=S)N(C)[C@H](C)c2ccc(S(N)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C20H27N3O2S2/c1-4-5-6-16-7-11-18(12-8-16)22-20(26)23(3)15(2)17-9-13-19(14-10-17)27(21,24)25/h7-15H,4-6H2,1-3H3,(H,22,26)(H2,21,24,25)/t15-/m1/s1 |
| InChIKey | LSHQLMRFZRXJJH-OAHLLOKOSA-N |
| XLogP | 4.07 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.59 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|