C18H23N3O2S2 — CID 9215572
3-(2,5-dimethylphenyl)-1-methyl-1-[(1S)-1-(4-sulfamoylphenyl)ethyl]thiourea (PubChem CID 9215572) has the molecular formula C18H23N3O2S2 and a molecular weight of 377.54 g/mol. Its IUPAC name is 3-(2,5-dimethylphenyl)-1-methyl-1-[(1S)-1-(4-sulfamoylphenyl)ethyl]thiourea.
| Compound Name | 3-(2,5-dimethylphenyl)-1-methyl-1-[(1S)-1-(4-sulfamoylphenyl)ethyl]thiourea |
|---|---|
| PubChem CID | 9215572 |
| Molecular Formula | C18H23N3O2S2 |
| Molecular Weight | 377.54 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | 3-(2,5-dimethylphenyl)-1-methyl-1-[(1S)-1-(4-sulfamoylphenyl)ethyl]thiourea |
| SMILES | Cc1ccc(C)c(NC(=S)N(C)[C@@H](C)c2ccc(S(N)(=O)=O)cc2)c1 |
| InChI | InChI=1S/C18H23N3O2S2/c1-12-5-6-13(2)17(11-12)20-18(24)21(4)14(3)15-7-9-16(10-8-15)25(19,22)23/h5-11,14H,1-4H3,(H,20,24)(H2,19,22,23)/t14-/m0/s1 |
| InChIKey | YYCZGOOEPSGABU-AWEZNQCLSA-N |
| XLogP | 3.34 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.54 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|