C15H25N3O2S2 — CID 19651786
1-(2-ethylhexyl)-3-(4-sulfamoylphenyl)thiourea (PubChem CID 19651786) has the molecular formula C15H25N3O2S2 and a molecular weight of 343.52 g/mol. Its IUPAC name is 1-(2-ethylhexyl)-3-(4-sulfamoylphenyl)thiourea.
| Compound Name | 1-(2-ethylhexyl)-3-(4-sulfamoylphenyl)thiourea |
|---|---|
| PubChem CID | 19651786 |
| Molecular Formula | C15H25N3O2S2 |
| Molecular Weight | 343.52 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | 1-(2-ethylhexyl)-3-(4-sulfamoylphenyl)thiourea |
| SMILES | CCCCC(CC)CNC(=S)Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C15H25N3O2S2/c1-3-5-6-12(4-2)11-17-15(21)18-13-7-9-14(10-8-13)22(16,19)20/h7-10,12H,3-6,11H2,1-2H3,(H2,16,19,20)(H2,17,18,21) |
| InChIKey | RKDWJZGFNKFVKQ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.52 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|