C20H36IN5O3S — CID 111127840
2-[[N-(2-ethylhexyl)-N'-[(4-sulfamoylphenyl)methyl]carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 111127840) has the molecular formula C20H36IN5O3S and a molecular weight of 553.51 g/mol. Its IUPAC name is 2-[[N-(2-ethylhexyl)-N'-[(4-sulfamoylphenyl)methyl]carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[N-(2-ethylhexyl)-N'-[(4-sulfamoylphenyl)methyl]carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 111127840 |
| Molecular Formula | C20H36IN5O3S |
| Molecular Weight | 553.51 g/mol |
| Exact Mass | 553.16 |
| IUPAC Name | 2-[[N-(2-ethylhexyl)-N'-[(4-sulfamoylphenyl)methyl]carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | CCCCC(CC)CN/C(=N/Cc1ccc(S(N)(=O)=O)cc1)NCC(=O)N(C)C.I |
| InChI | InChI=1S/C20H35N5O3S.HI/c1-5-7-8-16(6-2)13-22-20(24-15-19(26)25(3)4)23-14-17-9-11-18(12-10-17)29(21,27)28;/h9-12,16H,5-8,13-15H2,1-4H3,(H2,21,27,28)(H2,22,23,24);1H |
| InChIKey | FJEMUFPNIMXKAM-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 116.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.51 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|