C19H25N3O3S — CID 119689419
3-amino-N,2-dimethyl-3-phenyl-N-[1-(4-sulfamoylphenyl)ethyl]propanamide (PubChem CID 119689419) has the molecular formula C19H25N3O3S and a molecular weight of 375.49 g/mol. Its IUPAC name is 3-amino-N,2-dimethyl-3-phenyl-N-[1-(4-sulfamoylphenyl)ethyl]propanamide.
| Compound Name | 3-amino-N,2-dimethyl-3-phenyl-N-[1-(4-sulfamoylphenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 119689419 |
| Molecular Formula | C19H25N3O3S |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | 3-amino-N,2-dimethyl-3-phenyl-N-[1-(4-sulfamoylphenyl)ethyl]propanamide |
| SMILES | CC(C(=O)N(C)C(C)c1ccc(S(N)(=O)=O)cc1)C(N)c1ccccc1 |
| InChI | InChI=1S/C19H25N3O3S/c1-13(18(20)16-7-5-4-6-8-16)19(23)22(3)14(2)15-9-11-17(12-10-15)26(21,24)25/h4-14,18H,20H2,1-3H3,(H2,21,24,25) |
| InChIKey | UYDODRAEURGHMT-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 106.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |